C15H14N2O3S — CID 90666442
2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol (PubChem CID 90666442) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol.
| Compound Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol |
|---|---|
| PubChem CID | 90666442 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[1-(benzenesulfonyl)pyrrolo[2,3-b]pyridin-2-yl]ethanol |
| SMILES | O=S(=O)(c1ccccc1)n1c(CCO)cc2cccnc21 |
| InChI | InChI=1S/C15H14N2O3S/c18-10-8-13-11-12-5-4-9-16-15(12)17(13)21(19,20)14-6-2-1-3-7-14/h1-7,9,11,18H,8,10H2 |
| InChIKey | UFCRQIDPDFAARP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |