C40H40N4O7S — CID 90666457
2-[(2Z,4E)-5-[2-[(1S)-1-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoyl]oxyacetic acid (PubChem CID 90666457) has the molecular formula C40H40N4O7S and a molecular weight of 720.85 g/mol. Its IUPAC name is 2-[(2Z,4E)-5-[2-[(1S)-1-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoyl]oxyacetic acid.
| Compound Name | 2-[(2Z,4E)-5-[2-[(1S)-1-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoyl]oxyacetic acid |
|---|---|
| PubChem CID | 90666457 |
| Molecular Formula | C40H40N4O7S |
| Molecular Weight | 720.85 g/mol |
| Exact Mass | 720.26 |
| IUPAC Name | 2-[(2Z,4E)-5-[2-[(1S)-1-[[(2S)-2-acetamido-3-(1H-indol-3-yl)propanoyl]amino]-2-(4-phenylmethoxyphenyl)ethyl]-1,3-thiazol-4-yl]-2,4-dimethylpenta-2,4-dienoyl]oxyacetic acid |
| SMILES | CC(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)c1nc(/C=C(C)/C=C(/C)C(=O)OCC(=O)O)cs1 |
| InChI | InChI=1S/C40H40N4O7S/c1-25(17-26(2)40(49)51-23-37(46)47)18-31-24-52-39(43-31)36(19-28-13-15-32(16-14-28)50-22-29-9-5-4-6-10-29)44-38(48)35(42-27(3)45)20-30-21-41-34-12-8-7-11-33(30)34/h4-18,21,24,35-36,41H,19-20,22-23H2,1-3H3,(H,42,45)(H,44,48)(H,46,47)/b25-18+,26-17-/t35-,36-/m0/s1 |
| InChIKey | HUKAVDBFMUKEQS-SFMWDZFWSA-N |
| XLogP | 6.33 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.85 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|