C10H14O2 — CID 90666465
(1R,2S,4Z,8R)-11-oxabicyclo[6.2.1]undeca-4,9-dien-2-ol (PubChem CID 90666465) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,2S,4Z,8R)-11-oxabicyclo[6.2.1]undeca-4,9-dien-2-ol.
| Compound Name | (1R,2S,4Z,8R)-11-oxabicyclo[6.2.1]undeca-4,9-dien-2-ol |
|---|---|
| PubChem CID | 90666465 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,2S,4Z,8R)-11-oxabicyclo[6.2.1]undeca-4,9-dien-2-ol |
| SMILES | O[C@H]1C/C=C\CC[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C10H14O2/c11-9-5-3-1-2-4-8-6-7-10(9)12-8/h1,3,6-11H,2,4-5H2/b3-1-/t8-,9+,10-/m1/s1 |
| InChIKey | CCKYANUTDWTJDR-WADQILMQSA-N |
| XLogP | 1.41 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|