C22H31N4O3+ — CID 90666547
1-[2-[2-[2-[2-(benzimidazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-N,N-dimethylpyridin-1-ium-4-amine (PubChem CID 90666547) has the molecular formula C22H31N4O3+ and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(benzimidazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-N,N-dimethylpyridin-1-ium-4-amine.
| Compound Name | 1-[2-[2-[2-[2-(benzimidazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-N,N-dimethylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 90666547 |
| Molecular Formula | C22H31N4O3+ |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-[2-[2-[2-[2-(benzimidazol-1-yl)ethoxy]ethoxy]ethoxy]ethyl]-N,N-dimethylpyridin-1-ium-4-amine |
| SMILES | CN(C)c1cc[n+](CCOCCOCCOCCn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C22H31N4O3/c1-24(2)20-7-9-25(10-8-20)11-13-27-15-17-29-18-16-28-14-12-26-19-23-21-5-3-4-6-22(21)26/h3-10,19H,11-18H2,1-2H3/q+1 |
| InChIKey | SZSCDJJKZKDHMT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|