C28H21N3O4 — CID 90666824
5-[[1-(4-methoxyphenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 90666824) has the molecular formula C28H21N3O4 and a molecular weight of 463.49 g/mol. Its IUPAC name is 5-[[1-(4-methoxyphenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[1-(4-methoxyphenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 90666824 |
| Molecular Formula | C28H21N3O4 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | 5-[[1-(4-methoxyphenyl)-2,5-diphenylpyrrol-3-yl]methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(-n2c(-c3ccccc3)cc(C=C3C(=O)NC(=O)NC3=O)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H21N3O4/c1-35-22-14-12-21(13-15-22)31-24(18-8-4-2-5-9-18)17-20(25(31)19-10-6-3-7-11-19)16-23-26(32)29-28(34)30-27(23)33/h2-17H,1H3,(H2,29,30,32,33,34) |
| InChIKey | IKIAAOILSOOQDQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|