C27H41NO6 — CID 90666871
[(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,4R,5R)-4-hydroxy-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 90666871) has the molecular formula C27H41NO6 and a molecular weight of 475.63 g/mol. Its IUPAC name is [(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,4R,5R)-4-hydroxy-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,4R,5R)-4-hydroxy-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 90666871 |
| Molecular Formula | C27H41NO6 |
| Molecular Weight | 475.63 g/mol |
| Exact Mass | 475.29 |
| IUPAC Name | [(Z,2S)-5-[[4-[(2E,4E)-5-[(3R,4R,5R)-4-hydroxy-7,7-dimethyl-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)/C=C\C(=O)NC1CCC(C/C=C(C)/C=C/[C@H]2OC(C)(C)C[C@@]3(CO3)[C@@H]2O)CC1 |
| InChI | InChI=1S/C27H41NO6/c1-18(7-14-23-25(31)27(17-32-27)16-26(4,5)34-23)6-9-21-10-12-22(13-11-21)28-24(30)15-8-19(2)33-20(3)29/h6-8,14-15,19,21-23,25,31H,9-13,16-17H2,1-5H3,(H,28,30)/b14-7+,15-8-,18-6+/t19-,21?,22?,23+,25+,27+/m0/s1 |
| InChIKey | UKIBQUCRXNUREB-FGBITNSWSA-N |
| XLogP | 3.76 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|