C26H36O7 — CID 90666873
[(2S,4E,6S,7R)-7-hydroxy-2-[(E)-4-[(4-methoxyphenyl)methoxy]but-2-en-2-yl]-7-methyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate (PubChem CID 90666873) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is [(2S,4E,6S,7R)-7-hydroxy-2-[(E)-4-[(4-methoxyphenyl)methoxy]but-2-en-2-yl]-7-methyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate.
| Compound Name | [(2S,4E,6S,7R)-7-hydroxy-2-[(E)-4-[(4-methoxyphenyl)methoxy]but-2-en-2-yl]-7-methyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
|---|---|
| PubChem CID | 90666873 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [(2S,4E,6S,7R)-7-hydroxy-2-[(E)-4-[(4-methoxyphenyl)methoxy]but-2-en-2-yl]-7-methyl-12-oxo-1-oxacyclododec-4-en-6-yl] acetate |
| SMILES | COc1ccc(COC/C=C(\C)[C@@H]2C/C=C/[C@H](OC(C)=O)[C@](C)(O)CCCCC(=O)O2)cc1 |
| InChI | InChI=1S/C26H36O7/c1-19(15-17-31-18-21-11-13-22(30-4)14-12-21)23-8-7-9-24(32-20(2)27)26(3,29)16-6-5-10-25(28)33-23/h7,9,11-15,23-24,29H,5-6,8,10,16-18H2,1-4H3/b9-7+,19-15+/t23-,24-,26+/m0/s1 |
| InChIKey | OMGJVHZDGKDSIE-VSZAKUGESA-N |
| XLogP | 4.27 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|