C20H19N2OS+ — CID 90666938
2-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium (PubChem CID 90666938) has the molecular formula C20H19N2OS+ and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium.
| Compound Name | 2-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium |
|---|---|
| PubChem CID | 90666938 |
| Molecular Formula | C20H19N2OS+ |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 2-[(E,3Z)-3-(3,5-dimethyl-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium |
| SMILES | Cc1ccc2c(c1)N(C)/C(=C/C=C/c1oc3ccccc3[n+]1C)S2 |
| InChI | InChI=1S/C20H19N2OS/c1-14-11-12-18-16(13-14)22(3)20(24-18)10-6-9-19-21(2)15-7-4-5-8-17(15)23-19/h4-13H,1-3H3/q+1 |
| InChIKey | CZJUKVRGYGHNGF-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|