C21H21ClN2OS — CID 90666941
(2Z)-2-[(E)-3-(3,5-dimethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride (PubChem CID 90666941) has the molecular formula C21H21ClN2OS and a molecular weight of 384.93 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(3,5-dimethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride.
| Compound Name | (2Z)-2-[(E)-3-(3,5-dimethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride |
|---|---|
| PubChem CID | 90666941 |
| Molecular Formula | C21H21ClN2OS |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (2Z)-2-[(E)-3-(3,5-dimethyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride |
| SMILES | Cc1ccc2c(c1)N(C)/C(=C/C=C/c1sc3ccc(C)cc3[n+]1C)O2.[Cl-] |
| InChI | InChI=1S/C21H21N2OS.ClH/c1-14-8-10-18-16(12-14)22(3)20(24-18)6-5-7-21-23(4)17-13-15(2)9-11-19(17)25-21;/h5-13H,1-4H3;1H/q+1;/p-1 |
| InChIKey | SVGYPJXEKLZJGV-UHFFFAOYSA-M |
| XLogP | 1.73 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|