C20H18Cl2N2OS — CID 90666945
(2Z)-2-[(E)-3-(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride (PubChem CID 90666945) has the molecular formula C20H18Cl2N2OS and a molecular weight of 405.35 g/mol. Its IUPAC name is (2Z)-2-[(E)-3-(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride.
| Compound Name | (2Z)-2-[(E)-3-(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride |
|---|---|
| PubChem CID | 90666945 |
| Molecular Formula | C20H18Cl2N2OS |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 404.05 |
| IUPAC Name | (2Z)-2-[(E)-3-(5-chloro-3-methyl-1,3-benzothiazol-3-ium-2-yl)prop-2-enylidene]-3,5-dimethyl-1,3-benzoxazole chloride |
| SMILES | Cc1ccc2c(c1)N(C)/C(=C/C=C/c1sc3ccc(Cl)cc3[n+]1C)O2.[Cl-] |
| InChI | InChI=1S/C20H18ClN2OS.ClH/c1-13-7-9-17-15(11-13)22(2)19(24-17)5-4-6-20-23(3)16-12-14(21)8-10-18(16)25-20;/h4-12H,1-3H3;1H/q+1;/p-1 |
| InChIKey | SSPSKYYVIVNCOK-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|