C20H18ClFN2OS — CID 90666959
2-[(E,3Z)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium chloride (PubChem CID 90666959) has the molecular formula C20H18ClFN2OS and a molecular weight of 388.90 g/mol. Its IUPAC name is 2-[(E,3Z)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium chloride.
| Compound Name | 2-[(E,3Z)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium chloride |
|---|---|
| PubChem CID | 90666959 |
| Molecular Formula | C20H18ClFN2OS |
| Molecular Weight | 388.90 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 2-[(E,3Z)-3-(3-ethyl-5-fluoro-1,3-benzothiazol-2-ylidene)prop-1-enyl]-3-methyl-1,3-benzoxazol-3-ium chloride |
| SMILES | CCN1/C(=C/C=C/c2oc3ccccc3[n+]2C)Sc2ccc(F)cc21.[Cl-] |
| InChI | InChI=1S/C20H18FN2OS.ClH/c1-3-23-16-13-14(21)11-12-18(16)25-20(23)10-6-9-19-22(2)15-7-4-5-8-17(15)24-19;/h4-13H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LPZDQERSHWJJOT-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 20.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.90 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|