C14H18O2 — CID 90666996
2-[(2E,4E)-hexa-2,4-dienylidene]-5,5-dimethylcyclohexane-1,3-dione (PubChem CID 90666996) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 2-[(2E,4E)-hexa-2,4-dienylidene]-5,5-dimethylcyclohexane-1,3-dione.
| Compound Name | 2-[(2E,4E)-hexa-2,4-dienylidene]-5,5-dimethylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 90666996 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 2-[(2E,4E)-hexa-2,4-dienylidene]-5,5-dimethylcyclohexane-1,3-dione |
| SMILES | C/C=C/C=C/C=C1C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C14H18O2/c1-4-5-6-7-8-11-12(15)9-14(2,3)10-13(11)16/h4-8H,9-10H2,1-3H3/b5-4+,7-6+ |
| InChIKey | NDVPRXLWODBNLF-YTXTXJHMSA-N |
| XLogP | 3.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|