About (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one
(2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one (PubChem CID 90667037) has the molecular formula C22H21NO2
and a molecular weight of 331.42 g/mol. Its IUPAC name is (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one.
Molecular Properties
| Compound Name | (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one |
| PubChem CID | 90667037 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one |
| SMILES | Cc1cc(/C=C2\CCc3c(n(C)c4ccccc34)C2=O)cc(C)c1O |
| InChI | InChI=1S/C22H21NO2/c1-13-10-15(11-14(2)21(13)24)12-16-8-9-18-17-6-4-5-7-19(17)23(3)20(18)22(16)25/h4-7,10-12,24H,8-9H2,1-3H3/b16-12+ |
| InChIKey | TWSSVOYRRJDNOS-FOWTUZBSSA-N |
| XLogP | 4.71 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one?
The IUPAC name of (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one (CID 90667037) is (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one.
What is the SMILES notation for (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one?
The canonical SMILES for (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one is Cc1cc(/C=C2\CCc3c(n(C)c4ccccc34)C2=O)cc(C)c1O.
What is the InChIKey of (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one?
The InChIKey is TWSSVOYRRJDNOS-FOWTUZBSSA-N. The full InChI is InChI=1S/C22H21NO2/c1-13-10-15(11-14(2)21(13)24)12-16-8-9-18-17-6-4-5-7-19(17)23(3)20(18)22(16)25/h4-7,10-12,24H,8-9H2,1-3H3/b16-12+.
What are the key properties of (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one?
(2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one has a molecular weight of 331.42 g/mol, XLogP of 4.71, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(4-hydroxy-3,5-dimethylphenyl)methylidene]-9-methyl-3,4-dihydrocarbazol-1-one is sourced from PubChem (CID 90667037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).