C23H14Cl4N2O5 — CID 90667181
[4-[3-(3,5-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]cyclopent-2-en-1-yl] 3,5-dichlorobenzoate (PubChem CID 90667181) has the molecular formula C23H14Cl4N2O5 and a molecular weight of 540.19 g/mol. Its IUPAC name is [4-[3-(3,5-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]cyclopent-2-en-1-yl] 3,5-dichlorobenzoate.
| Compound Name | [4-[3-(3,5-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]cyclopent-2-en-1-yl] 3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 90667181 |
| Molecular Formula | C23H14Cl4N2O5 |
| Molecular Weight | 540.19 g/mol |
| Exact Mass | 537.97 |
| IUPAC Name | [4-[3-(3,5-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]cyclopent-2-en-1-yl] 3,5-dichlorobenzoate |
| SMILES | O=C(OC1C=CC(n2ccc(=O)n(C(=O)c3cc(Cl)cc(Cl)c3)c2=O)C1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C23H14Cl4N2O5/c24-14-5-12(6-15(25)9-14)21(31)29-20(30)3-4-28(23(29)33)18-1-2-19(11-18)34-22(32)13-7-16(26)10-17(27)8-13/h1-10,18-19H,11H2 |
| InChIKey | XCOMBOLFVRVKEU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 87.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.19 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|