C21H24N6O — CID 90667235
3,3-diphenyl-N-[N'-[3-(1H-1,2,4-triazol-5-yl)propyl]carbamimidoyl]propanamide (PubChem CID 90667235) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 3,3-diphenyl-N-[N'-[3-(1H-1,2,4-triazol-5-yl)propyl]carbamimidoyl]propanamide.
| Compound Name | 3,3-diphenyl-N-[N'-[3-(1H-1,2,4-triazol-5-yl)propyl]carbamimidoyl]propanamide |
|---|---|
| PubChem CID | 90667235 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3,3-diphenyl-N-[N'-[3-(1H-1,2,4-triazol-5-yl)propyl]carbamimidoyl]propanamide |
| SMILES | N/C(=N\CCCc1ncn[nH]1)NC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N6O/c22-21(23-13-7-12-19-24-15-25-27-19)26-20(28)14-18(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-6,8-11,15,18H,7,12-14H2,(H,24,25,27)(H3,22,23,26,28) |
| InChIKey | LCGNLHLIZIMPIZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|