C16H22N8S — CID 90667246
2-[4-(3-amino-1H-1,2,4-triazol-5-yl)butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 90667246) has the molecular formula C16H22N8S and a molecular weight of 358.48 g/mol. Its IUPAC name is 2-[4-(3-amino-1H-1,2,4-triazol-5-yl)butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 2-[4-(3-amino-1H-1,2,4-triazol-5-yl)butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 90667246 |
| Molecular Formula | C16H22N8S |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-[4-(3-amino-1H-1,2,4-triazol-5-yl)butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | N#CN/C(=N\CCCCc1nc(N)n[nH]1)NCCSc1ccccc1 |
| InChI | InChI=1S/C16H22N8S/c17-12-21-16(20-10-11-25-13-6-2-1-3-7-13)19-9-5-4-8-14-22-15(18)24-23-14/h1-3,6-7H,4-5,8-11H2,(H2,19,20,21)(H3,18,22,23,24) |
| InChIKey | ASNXLJAURZJRJQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 127.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|