C8H15N9 — CID 90667247
1-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propyl]-3-cyano-2-methylguanidine (PubChem CID 90667247) has the molecular formula C8H15N9 and a molecular weight of 237.27 g/mol. Its IUPAC name is 1-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propyl]-3-cyano-2-methylguanidine.
| Compound Name | 1-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propyl]-3-cyano-2-methylguanidine |
|---|---|
| PubChem CID | 90667247 |
| Molecular Formula | C8H15N9 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-[3-[(5-amino-1H-1,2,4-triazol-3-yl)amino]propyl]-3-cyano-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCCNc1n[nH]c(N)n1 |
| InChI | InChI=1S/C8H15N9/c1-11-7(14-5-9)12-3-2-4-13-8-15-6(10)16-17-8/h2-4H2,1H3,(H2,11,12,14)(H4,10,13,15,16,17) |
| InChIKey | ZQODQNNRCUJZNL-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|