C16H23N9S — CID 90667250
2-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine (PubChem CID 90667250) has the molecular formula C16H23N9S and a molecular weight of 373.49 g/mol. Its IUPAC name is 2-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine.
| Compound Name | 2-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 90667250 |
| Molecular Formula | C16H23N9S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 2-[4-[(5-amino-1H-1,2,4-triazol-3-yl)amino]butyl]-1-cyano-3-(2-phenylsulfanylethyl)guanidine |
| SMILES | N#CN/C(=N\CCCCNc1n[nH]c(N)n1)NCCSc1ccccc1 |
| InChI | InChI=1S/C16H23N9S/c17-12-22-15(21-10-11-26-13-6-2-1-3-7-13)19-8-4-5-9-20-16-23-14(18)24-25-16/h1-3,6-7H,4-5,8-11H2,(H2,19,21,22)(H4,18,20,23,24,25) |
| InChIKey | BTLGXJUDLJOGSO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|