C34H33ClF3N3O4 — CID 90667272
(3S,4'R,6'S)-6-chloro-4'-[2-[1-(4,4-difluoropiperidin-1-yl)-2-methyl-1-oxopropan-2-yl]oxyphenyl]-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 90667272) has the molecular formula C34H33ClF3N3O4 and a molecular weight of 640.10 g/mol. Its IUPAC name is (3S,4'R,6'S)-6-chloro-4'-[2-[1-(4,4-difluoropiperidin-1-yl)-2-methyl-1-oxopropan-2-yl]oxyphenyl]-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3S,4'R,6'S)-6-chloro-4'-[2-[1-(4,4-difluoropiperidin-1-yl)-2-methyl-1-oxopropan-2-yl]oxyphenyl]-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 90667272 |
| Molecular Formula | C34H33ClF3N3O4 |
| Molecular Weight | 640.10 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | (3S,4'R,6'S)-6-chloro-4'-[2-[1-(4,4-difluoropiperidin-1-yl)-2-methyl-1-oxopropan-2-yl]oxyphenyl]-6'-(5-fluoro-2-methylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | Cc1ccc(F)cc1[C@@H]1NC(=O)C[C@H](c2ccccc2OC(C)(C)C(=O)N2CCC(F)(F)CC2)[C@@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C34H33ClF3N3O4/c1-19-8-10-21(36)17-23(19)29-34(24-11-9-20(35)16-26(24)39-30(34)43)25(18-28(42)40-29)22-6-4-5-7-27(22)45-32(2,3)31(44)41-14-12-33(37,38)13-15-41/h4-11,16-17,25,29H,12-15,18H2,1-3H3,(H,39,43)(H,40,42)/t25-,29+,34-/m1/s1 |
| InChIKey | AQHATUXFLMVGNX-CDKXIZBOSA-N |
| XLogP | 6.44 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.10 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |