About methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate
methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate (PubChem CID 90667277) has the molecular formula C21H20Cl2N2O2
and a molecular weight of 403.31 g/mol. Its IUPAC name is methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate |
| PubChem CID | 90667277 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate |
| SMILES | COC(=O)[C@]1(c2ccc(Cl)cc2)N=CN(CC2CC2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H20Cl2N2O2/c1-27-20(26)21(16-6-10-18(23)11-7-16)19(15-4-8-17(22)9-5-15)25(13-24-21)12-14-2-3-14/h4-11,13-14,19H,2-3,12H2,1H3/t19-,21+/m0/s1 |
| InChIKey | TWIKWHQOMXDELG-PZJWPPBQSA-N |
| XLogP | 4.86 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate?
The IUPAC name of methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate (CID 90667277) is methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate.
What is the SMILES notation for methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate?
The canonical SMILES for methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate is COC(=O)[C@]1(c2ccc(Cl)cc2)N=CN(CC2CC2)[C@H]1c1ccc(Cl)cc1.
What is the InChIKey of methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate?
The InChIKey is TWIKWHQOMXDELG-PZJWPPBQSA-N. The full InChI is InChI=1S/C21H20Cl2N2O2/c1-27-20(26)21(16-6-10-18(23)11-7-16)19(15-4-8-17(22)9-5-15)25(13-24-21)12-14-2-3-14/h4-11,13-14,19H,2-3,12H2,1H3/t19-,21+/m0/s1.
What are the key properties of methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate?
methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate has a molecular weight of 403.31 g/mol, XLogP of 4.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5R)-4,5-bis(4-chlorophenyl)-3-(cyclopropylmethyl)-4H-imidazole-5-carboxylate is sourced from PubChem (CID 90667277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).