C30H40N4O6 — CID 90667452
propan-2-yl N-[(2S,4R)-1-acetyl-6-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate (PubChem CID 90667452) has the molecular formula C30H40N4O6 and a molecular weight of 552.67 g/mol. Its IUPAC name is propan-2-yl N-[(2S,4R)-1-acetyl-6-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S,4R)-1-acetyl-6-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
|---|---|
| PubChem CID | 90667452 |
| Molecular Formula | C30H40N4O6 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | propan-2-yl N-[(2S,4R)-1-acetyl-6-[4-[[8-(hydroxyamino)-8-oxooctanoyl]amino]phenyl]-2-methyl-3,4-dihydro-2H-quinolin-4-yl]carbamate |
| SMILES | CC(=O)N1c2ccc(-c3ccc(NC(=O)CCCCCCC(=O)NO)cc3)cc2[C@H](NC(=O)OC(C)C)C[C@@H]1C |
| InChI | InChI=1S/C30H40N4O6/c1-19(2)40-30(38)32-26-17-20(3)34(21(4)35)27-16-13-23(18-25(26)27)22-11-14-24(15-12-22)31-28(36)9-7-5-6-8-10-29(37)33-39/h11-16,18-20,26,39H,5-10,17H2,1-4H3,(H,31,36)(H,32,38)(H,33,37)/t20-,26+/m0/s1 |
| InChIKey | JLNZMTDBARFXJN-RXFWQSSRSA-N |
| XLogP | 5.46 |
| TPSA | 137.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|