C22H22F2N8O3 — CID 90667670
2-(2,4-difluorophenyl)-1-[methyl-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 90667670) has the molecular formula C22H22F2N8O3 and a molecular weight of 484.47 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[methyl-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[methyl-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 90667670 |
| Molecular Formula | C22H22F2N8O3 |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[methyl-[[1-[(3-nitrophenyl)methyl]triazol-4-yl]methyl]amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | CN(Cc1cn(Cc2cccc([N+](=O)[O-])c2)nn1)CC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C22H22F2N8O3/c1-29(10-18-11-30(28-27-18)9-16-3-2-4-19(7-16)32(34)35)12-22(33,13-31-15-25-14-26-31)20-6-5-17(23)8-21(20)24/h2-8,11,14-15,33H,9-10,12-13H2,1H3 |
| InChIKey | BMCMNGPYELVJHQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|