C9H11NO2 — CID 90667887
2-methyl-3a,5,6,7-tetrahydro-2H-indole-3,4-dione (PubChem CID 90667887) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is 2-methyl-3a,5,6,7-tetrahydro-2H-indole-3,4-dione.
| Compound Name | 2-methyl-3a,5,6,7-tetrahydro-2H-indole-3,4-dione |
|---|---|
| PubChem CID | 90667887 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 2-methyl-3a,5,6,7-tetrahydro-2H-indole-3,4-dione |
| SMILES | CC1N=C2CCCC(=O)C2C1=O |
| InChI | InChI=1S/C9H11NO2/c1-5-9(12)8-6(10-5)3-2-4-7(8)11/h5,8H,2-4H2,1H3 |
| InChIKey | JUNCGVNVKPUQIX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|