C14H27N3O3S — CID 90668256
N,N,N',N',N",N"-hexamethylmethanetriamine;4-methylbenzenesulfonic acid (PubChem CID 90668256) has the molecular formula C14H27N3O3S and a molecular weight of 317.46 g/mol. Its IUPAC name is N,N,N',N',N",N"-hexamethylmethanetriamine;4-methylbenzenesulfonic acid.
| Compound Name | N,N,N',N',N",N"-hexamethylmethanetriamine;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 90668256 |
| Molecular Formula | C14H27N3O3S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N,N,N',N',N",N"-hexamethylmethanetriamine;4-methylbenzenesulfonic acid |
| SMILES | CN(C)C(N(C)C)N(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C7H19N3.C7H8O3S/c1-8(2)7(9(3)4)10(5)6;1-6-2-4-7(5-3-6)11(8,9)10/h7H,1-6H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | IINGWZXRTHGKBB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|