C17H20N4OS — CID 90668272
6-(azepan-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 90668272) has the molecular formula C17H20N4OS and a molecular weight of 328.44 g/mol. Its IUPAC name is 6-(azepan-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(azepan-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90668272 |
| Molecular Formula | C17H20N4OS |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 6-(azepan-1-ylmethyl)-2-(furan-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ccco2)nc2sc(CN3CCCCCC3)cc12 |
| InChI | InChI=1S/C17H20N4OS/c18-15-13-10-12(11-21-7-3-1-2-4-8-21)23-17(13)20-16(19-15)14-6-5-9-22-14/h5-6,9-10H,1-4,7-8,11H2,(H2,18,19,20) |
| InChIKey | SSJXHQWCBBLDCI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |