C14H13N5OS — CID 90668275
6-(2,5-dihydropyrrol-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 90668275) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is 6-(2,5-dihydropyrrol-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(2,5-dihydropyrrol-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90668275 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 6-(2,5-dihydropyrrol-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ncco2)nc2sc(CN3CC=CC3)cc12 |
| InChI | InChI=1S/C14H13N5OS/c15-11-10-7-9(8-19-4-1-2-5-19)21-14(10)18-12(17-11)13-16-3-6-20-13/h1-3,6-7H,4-5,8H2,(H2,15,17,18) |
| InChIKey | KTQWTFPDXSIZBM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|