C15H15N5OS — CID 90668276
6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 90668276) has the molecular formula C15H15N5OS and a molecular weight of 313.39 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 90668276 |
| Molecular Formula | C15H15N5OS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-ylmethyl)-2-(1,3-oxazol-2-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(-c2ncco2)nc2sc(CN3CC=CCC3)cc12 |
| InChI | InChI=1S/C15H15N5OS/c16-12-11-8-10(9-20-5-2-1-3-6-20)22-15(11)19-13(18-12)14-17-4-7-21-14/h1-2,4,7-8H,3,5-6,9H2,(H2,16,18,19) |
| InChIKey | SHKCYAQXYCFAIU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|