C21H18N2O10 — CID 90668286
(1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxy-5-nitrophenyl)hepta-1,4,6-trien-3-one (PubChem CID 90668286) has the molecular formula C21H18N2O10 and a molecular weight of 458.38 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxy-5-nitrophenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxy-5-nitrophenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 90668286 |
| Molecular Formula | C21H18N2O10 |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-1,7-bis(4-hydroxy-3-methoxy-5-nitrophenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1cc(/C=C/C(=O)/C=C(O)/C=C/c2cc(OC)c(O)c([N+](=O)[O-])c2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C21H18N2O10/c1-32-18-9-12(7-16(20(18)26)22(28)29)3-5-14(24)11-15(25)6-4-13-8-17(23(30)31)21(27)19(10-13)33-2/h3-11,24,26-27H,1-2H3/b5-3+,6-4+,14-11- |
| InChIKey | QRKTUJKCVIQROM-LJFKNHCYSA-N |
| XLogP | 3.67 |
| TPSA | 182.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|