C21H24ClN3 — CID 90668462
(3R,3aS,7E)-7-benzylidene-2,5-dimethyl-3-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride (PubChem CID 90668462) has the molecular formula C21H24ClN3 and a molecular weight of 353.90 g/mol. Its IUPAC name is (3R,3aS,7E)-7-benzylidene-2,5-dimethyl-3-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride.
| Compound Name | (3R,3aS,7E)-7-benzylidene-2,5-dimethyl-3-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride |
|---|---|
| PubChem CID | 90668462 |
| Molecular Formula | C21H24ClN3 |
| Molecular Weight | 353.90 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | (3R,3aS,7E)-7-benzylidene-2,5-dimethyl-3-phenyl-3,3a,4,6-tetrahydropyrazolo[4,3-c]pyridine;hydrochloride |
| SMILES | CN1C/C(=C\c2ccccc2)C2=NN(C)[C@@H](c3ccccc3)[C@@H]2C1.Cl |
| InChI | InChI=1S/C21H23N3.ClH/c1-23-14-18(13-16-9-5-3-6-10-16)20-19(15-23)21(24(2)22-20)17-11-7-4-8-12-17;/h3-13,19,21H,14-15H2,1-2H3;1H/b18-13+;/t19-,21+;/m1./s1 |
| InChIKey | MTNJPFUULFLECD-CNRDXXRZSA-N |
| XLogP | 4.10 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.90 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |