C17H20N2O5 — CID 90668499
3-(3,4-dihydroxyphenyl)-2-[(3-hydroxy-2,5-dimethyl-4-pyridinyl)methylamino]propanoic acid (PubChem CID 90668499) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-(3,4-dihydroxyphenyl)-2-[(3-hydroxy-2,5-dimethyl-4-pyridinyl)methylamino]propanoic acid.
| Compound Name | 3-(3,4-dihydroxyphenyl)-2-[(3-hydroxy-2,5-dimethyl-4-pyridinyl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 90668499 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 3-(3,4-dihydroxyphenyl)-2-[(3-hydroxy-2,5-dimethyl-4-pyridinyl)methylamino]propanoic acid |
| SMILES | Cc1cnc(C)c(O)c1CNC(Cc1ccc(O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C17H20N2O5/c1-9-7-18-10(2)16(22)12(9)8-19-13(17(23)24)5-11-3-4-14(20)15(21)6-11/h3-4,6-7,13,19-22H,5,8H2,1-2H3,(H,23,24) |
| InChIKey | UPDWLJNMTZMHFX-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|