About 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol
1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol (PubChem CID 90668823) has the molecular formula C24H25F6NO
and a molecular weight of 457.46 g/mol. Its IUPAC name is 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol.
Molecular Properties
| Compound Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol |
| PubChem CID | 90668823 |
| Molecular Formula | C24H25F6NO |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol |
| SMILES | CCCN(CCC)CC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H25F6NO/c1-3-9-31(10-4-2)14-22(32)21-11-15-5-6-16(23(25,26)27)12-19(15)20-13-17(24(28,29)30)7-8-18(20)21/h5-8,11-13,22,32H,3-4,9-10,14H2,1-2H3 |
| InChIKey | OLXULQQRJPFDQD-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol?
The IUPAC name of 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol (CID 90668823) is 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol.
What is the SMILES notation for 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol?
The canonical SMILES for 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol is CCCN(CCC)CC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12.
What is the InChIKey of 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol?
The InChIKey is OLXULQQRJPFDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25F6NO/c1-3-9-31(10-4-2)14-22(32)21-11-15-5-6-16(23(25,26)27)12-19(15)20-13-17(24(28,29)30)7-8-18(20)21/h5-8,11-13,22,32H,3-4,9-10,14H2,1-2H3.
What are the key properties of 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol?
1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol has a molecular weight of 457.46 g/mol, XLogP of 7.19, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(dipropylamino)ethanol is sourced from PubChem (CID 90668823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).