C25H27F6NO — CID 90668848
1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-(dipropylamino)propan-1-ol (PubChem CID 90668848) has the molecular formula C25H27F6NO and a molecular weight of 471.49 g/mol. Its IUPAC name is 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-(dipropylamino)propan-1-ol.
| Compound Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-(dipropylamino)propan-1-ol |
|---|---|
| PubChem CID | 90668848 |
| Molecular Formula | C25H27F6NO |
| Molecular Weight | 471.49 g/mol |
| Exact Mass | 471.20 |
| IUPAC Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-3-(dipropylamino)propan-1-ol |
| SMILES | CCCN(CCC)CCC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H27F6NO/c1-3-10-32(11-4-2)12-9-23(33)22-13-16-5-6-17(24(26,27)28)14-20(16)21-15-18(25(29,30)31)7-8-19(21)22/h5-8,13-15,23,33H,3-4,9-12H2,1-2H3 |
| InChIKey | WUKNBUUYGSINNQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.49 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|