C32H41F6NO — CID 90668869
1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(diheptylamino)ethanol (PubChem CID 90668869) has the molecular formula C32H41F6NO and a molecular weight of 569.67 g/mol. Its IUPAC name is 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(diheptylamino)ethanol.
| Compound Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(diheptylamino)ethanol |
|---|---|
| PubChem CID | 90668869 |
| Molecular Formula | C32H41F6NO |
| Molecular Weight | 569.67 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | 1-[3,6-bis(trifluoromethyl)phenanthren-9-yl]-2-(diheptylamino)ethanol |
| SMILES | CCCCCCCN(CCCCCCC)CC(O)c1cc2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C32H41F6NO/c1-3-5-7-9-11-17-39(18-12-10-8-6-4-2)22-30(40)29-19-23-13-14-24(31(33,34)35)20-27(23)28-21-25(32(36,37)38)15-16-26(28)29/h13-16,19-21,30,40H,3-12,17-18,22H2,1-2H3 |
| InChIKey | DRBZNRJRVQFPGE-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.67 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|