About 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol
2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol (PubChem CID 90669040) has the molecular formula C25H29Cl2FN2O
and a molecular weight of 463.42 g/mol. Its IUPAC name is 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol.
Molecular Properties
| Compound Name | 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol |
| PubChem CID | 90669040 |
| Molecular Formula | C25H29Cl2FN2O |
| Molecular Weight | 463.42 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol |
| SMILES | CCCCN(CCCC)CC(O)c1cc(-c2ccc(F)cc2)nc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C25H29Cl2FN2O/c1-3-5-11-30(12-6-4-2)16-24(31)20-15-23(17-7-9-19(28)10-8-17)29-25-21(20)13-18(26)14-22(25)27/h7-10,13-15,24,31H,3-6,11-12,16H2,1-2H3 |
| InChIKey | AUOPLSBLGVQPQF-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.42 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
The IUPAC name of 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol (CID 90669040) is 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol.
What is the SMILES notation for 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
The canonical SMILES for 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol is CCCCN(CCCC)CC(O)c1cc(-c2ccc(F)cc2)nc2c(Cl)cc(Cl)cc12.
What is the InChIKey of 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
The InChIKey is AUOPLSBLGVQPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29Cl2FN2O/c1-3-5-11-30(12-6-4-2)16-24(31)20-15-23(17-7-9-19(28)10-8-17)29-25-21(20)13-18(26)14-22(25)27/h7-10,13-15,24,31H,3-6,11-12,16H2,1-2H3.
What are the key properties of 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol?
2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol has a molecular weight of 463.42 g/mol, XLogP of 7.28, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)-1-[6,8-dichloro-2-(4-fluorophenyl)quinolin-4-yl]ethanol is sourced from PubChem (CID 90669040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).