About 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol
2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol (PubChem CID 90669705) has the molecular formula C19H26Cl2N2O
and a molecular weight of 369.34 g/mol. Its IUPAC name is 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol |
| PubChem CID | 90669705 |
| Molecular Formula | C19H26Cl2N2O |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol |
| SMILES | CCCCN(CCCC)CC(O)c1cnc2c(Cl)cc(Cl)cc2c1 |
| InChI | InChI=1S/C19H26Cl2N2O/c1-3-5-7-23(8-6-4-2)13-18(24)15-9-14-10-16(20)11-17(21)19(14)22-12-15/h9-12,18,24H,3-8,13H2,1-2H3 |
| InChIKey | PQLWHWLIMIMDRV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol?
The IUPAC name of 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol (CID 90669705) is 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol.
What is the SMILES notation for 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol?
The canonical SMILES for 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol is CCCCN(CCCC)CC(O)c1cnc2c(Cl)cc(Cl)cc2c1.
What is the InChIKey of 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol?
The InChIKey is PQLWHWLIMIMDRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26Cl2N2O/c1-3-5-7-23(8-6-4-2)13-18(24)15-9-14-10-16(20)11-17(21)19(14)22-12-15/h9-12,18,24H,3-8,13H2,1-2H3.
What are the key properties of 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol?
2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol has a molecular weight of 369.34 g/mol, XLogP of 5.48, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibutylamino)-1-(6,8-dichloroquinolin-3-yl)ethanol is sourced from PubChem (CID 90669705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).