C20H26N2O5 — CID 90669729
4-[(4aR,9bS)-8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-2-one;(Z)-but-2-enedioic acid (PubChem CID 90669729) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-[(4aR,9bS)-8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-2-one;(Z)-but-2-enedioic acid.
| Compound Name | 4-[(4aR,9bS)-8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-2-one;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 90669729 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 4-[(4aR,9bS)-8-methyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indol-2-yl]butan-2-one;(Z)-but-2-enedioic acid |
| SMILES | CC(=O)CCN1CC[C@H]2Nc3ccc(C)cc3[C@H]2C1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C16H22N2O.C4H4O4/c1-11-3-4-15-13(9-11)14-10-18(7-5-12(2)19)8-6-16(14)17-15;5-3(6)1-2-4(7)8/h3-4,9,14,16-17H,5-8,10H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-,16-;/m1./s1 |
| InChIKey | RURXHIDOMACVOK-RGPXEELESA-N |
| XLogP | 2.27 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|