C60H50N4O8S2 — CID 90669835
bis(4-methylbenzenesulfonate);N-(1-methylquinolin-1-ium-7-yl)-4-[4-[4-[4-[(1-methylquinolin-1-ium-7-yl)carbamoyl]phenyl]phenyl]phenyl]benzamide (PubChem CID 90669835) has the molecular formula C60H50N4O8S2 and a molecular weight of 1019.21 g/mol. Its IUPAC name is bis(4-methylbenzenesulfonate);N-(1-methylquinolin-1-ium-7-yl)-4-[4-[4-[4-[(1-methylquinolin-1-ium-7-yl)carbamoyl]phenyl]phenyl]phenyl]benzamide.
| Compound Name | bis(4-methylbenzenesulfonate);N-(1-methylquinolin-1-ium-7-yl)-4-[4-[4-[4-[(1-methylquinolin-1-ium-7-yl)carbamoyl]phenyl]phenyl]phenyl]benzamide |
|---|---|
| PubChem CID | 90669835 |
| Molecular Formula | C60H50N4O8S2 |
| Molecular Weight | 1019.21 g/mol |
| Exact Mass | 1018.31 |
| IUPAC Name | bis(4-methylbenzenesulfonate);N-(1-methylquinolin-1-ium-7-yl)-4-[4-[4-[4-[(1-methylquinolin-1-ium-7-yl)carbamoyl]phenyl]phenyl]phenyl]benzamide |
| SMILES | C[n+]1cccc2ccc(NC(=O)c3ccc(-c4ccc(-c5ccc(-c6ccc(C(=O)Nc7ccc8ccc[n+](C)c8c7)cc6)cc5)cc4)cc3)cc21.Cc1ccc(S(=O)(=O)[O-])cc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C46H34N4O2.2C7H8O3S/c1-49-27-3-5-37-23-25-41(29-43(37)49)47-45(51)39-19-15-35(16-20-39)33-11-7-31(8-12-33)32-9-13-34(14-10-32)36-17-21-40(22-18-36)46(52)48-42-26-24-38-6-4-28-50(2)44(38)30-42;2*1-6-2-4-7(5-3-6)11(8,9)10/h3-30H,1-2H3;2*2-5H,1H3,(H,8,9,10) |
| InChIKey | KIAGXPSALJZUOM-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 180.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1019.21 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|