C15H16N2O3 — CID 90669959
(6aS,8E)-8-ethylidene-4-methoxy-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione (PubChem CID 90669959) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is (6aS,8E)-8-ethylidene-4-methoxy-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione.
| Compound Name | (6aS,8E)-8-ethylidene-4-methoxy-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
|---|---|
| PubChem CID | 90669959 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (6aS,8E)-8-ethylidene-4-methoxy-5,6a,7,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepine-6,11-dione |
| SMILES | C/C=C1\C[C@H]2C(=O)Nc3c(OC)cccc3C(=O)N2C1 |
| InChI | InChI=1S/C15H16N2O3/c1-3-9-7-11-14(18)16-13-10(15(19)17(11)8-9)5-4-6-12(13)20-2/h3-6,11H,7-8H2,1-2H3,(H,16,18)/b9-3+/t11-/m0/s1 |
| InChIKey | DHXUSEYFJTWOSE-BWLWAFFFSA-N |
| XLogP | 1.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|