C32H39NO4 — CID 90670092
6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol (PubChem CID 90670092) has the molecular formula C32H39NO4 and a molecular weight of 501.67 g/mol. Its IUPAC name is 6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol.
| Compound Name | 6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol |
|---|---|
| PubChem CID | 90670092 |
| Molecular Formula | C32H39NO4 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | 6-[(E)-2-[(7R,8aR,10aR)-7-hydroxy-4-methoxy-8,8,10a-trimethyl-6,7,8a,9-tetrahydro-5H-xanthen-2-yl]ethenyl]-2-(3-methylbut-2-enyl)-1H-indol-4-ol |
| SMILES | COc1cc(/C=C/c2cc(O)c3cc(CC=C(C)C)[nH]c3c2)cc2c1O[C@]1(C)CC[C@@H](O)C(C)(C)[C@H]1C2 |
| InChI | InChI=1S/C32H39NO4/c1-19(2)7-10-23-18-24-25(33-23)14-21(15-26(24)34)9-8-20-13-22-17-28-31(3,4)29(35)11-12-32(28,5)37-30(22)27(16-20)36-6/h7-9,13-16,18,28-29,33-35H,10-12,17H2,1-6H3/b9-8+/t28-,29-,32-/m1/s1 |
| InChIKey | MNHNWDJTAYOITL-XTDLGYLMSA-N |
| XLogP | 7.05 |
| TPSA | 74.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|