About 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione
4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 90670233) has the molecular formula C20H18N4S
and a molecular weight of 346.46 g/mol. Its IUPAC name is 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione.
Molecular Properties
| Compound Name | 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione |
| PubChem CID | 90670233 |
| Molecular Formula | C20H18N4S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | CCn1c(N)c2cc(-c3ccccc3)n(-c3ccccc3)c2nc1=S |
| InChI | InChI=1S/C20H18N4S/c1-2-23-18(21)16-13-17(14-9-5-3-6-10-14)24(19(16)22-20(23)25)15-11-7-4-8-12-15/h3-13H,2,21H2,1H3 |
| InChIKey | XVASCWYVGNXSLM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione?
The IUPAC name of 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione (CID 90670233) is 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione.
What is the SMILES notation for 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione?
The canonical SMILES for 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione is CCn1c(N)c2cc(-c3ccccc3)n(-c3ccccc3)c2nc1=S.
What is the InChIKey of 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione?
The InChIKey is XVASCWYVGNXSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4S/c1-2-23-18(21)16-13-17(14-9-5-3-6-10-14)24(19(16)22-20(23)25)15-11-7-4-8-12-15/h3-13H,2,21H2,1H3.
What are the key properties of 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione?
4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione has a molecular weight of 346.46 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-ethyl-6,7-diphenylpyrrolo[2,3-d]pyrimidine-2-thione is sourced from PubChem (CID 90670233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).