C19H28O3 — CID 90670335
(1S,6R,10R,12R)-12-ethenyl-1-(hydroxymethyl)-7,7,12-trimethyl-5-oxatricyclo[8.4.0.02,6]tetradec-2-en-4-one (PubChem CID 90670335) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (1S,6R,10R,12R)-12-ethenyl-1-(hydroxymethyl)-7,7,12-trimethyl-5-oxatricyclo[8.4.0.02,6]tetradec-2-en-4-one.
| Compound Name | (1S,6R,10R,12R)-12-ethenyl-1-(hydroxymethyl)-7,7,12-trimethyl-5-oxatricyclo[8.4.0.02,6]tetradec-2-en-4-one |
|---|---|
| PubChem CID | 90670335 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1S,6R,10R,12R)-12-ethenyl-1-(hydroxymethyl)-7,7,12-trimethyl-5-oxatricyclo[8.4.0.02,6]tetradec-2-en-4-one |
| SMILES | C=C[C@]1(C)CC[C@@]2(CO)C3=CC(=O)O[C@@H]3C(C)(C)CC[C@@H]2C1 |
| InChI | InChI=1S/C19H28O3/c1-5-18(4)8-9-19(12-20)13(11-18)6-7-17(2,3)16-14(19)10-15(21)22-16/h5,10,13,16,20H,1,6-9,11-12H2,2-4H3/t13-,16+,18-,19+/m1/s1 |
| InChIKey | NIKHROFAFUSZHD-HQJJXPTPSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|