About (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one
(E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one (PubChem CID 90670528) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one.
Molecular Properties
| Compound Name | (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one |
| PubChem CID | 90670528 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/c2ccc3c(ccn3C)c2)c2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C24H23NO3/c1-24(2)13-11-19-22(27-4)10-7-18(23(19)28-24)21(26)9-6-16-5-8-20-17(15-16)12-14-25(20)3/h5-15H,1-4H3/b9-6+ |
| InChIKey | VQFZBJDNIVNIEU-RMKNXTFCSA-N |
| XLogP | 5.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one?
The IUPAC name of (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one (CID 90670528) is (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one.
What is the SMILES notation for (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one?
The canonical SMILES for (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one is COc1ccc(C(=O)/C=C/c2ccc3c(ccn3C)c2)c2c1C=CC(C)(C)O2.
What is the InChIKey of (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one?
The InChIKey is VQFZBJDNIVNIEU-RMKNXTFCSA-N. The full InChI is InChI=1S/C24H23NO3/c1-24(2)13-11-19-22(27-4)10-7-18(23(19)28-24)21(26)9-6-16-5-8-20-17(15-16)12-14-25(20)3/h5-15H,1-4H3/b9-6+.
What are the key properties of (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one?
(E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one has a molecular weight of 373.45 g/mol, XLogP of 5.27, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(5-methoxy-2,2-dimethylchromen-8-yl)-3-(1-methylindol-5-yl)prop-2-en-1-one is sourced from PubChem (CID 90670528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).