C23H25NO6 — CID 90670570
2,4-bis(3,4,5-trimethoxyphenyl)pyridine (PubChem CID 90670570) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2,4-bis(3,4,5-trimethoxyphenyl)pyridine.
| Compound Name | 2,4-bis(3,4,5-trimethoxyphenyl)pyridine |
|---|---|
| PubChem CID | 90670570 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 2,4-bis(3,4,5-trimethoxyphenyl)pyridine |
| SMILES | COc1cc(-c2ccnc(-c3cc(OC)c(OC)c(OC)c3)c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H25NO6/c1-25-18-10-15(11-19(26-2)22(18)29-5)14-7-8-24-17(9-14)16-12-20(27-3)23(30-6)21(13-16)28-4/h7-13H,1-6H3 |
| InChIKey | MJBYLDYUWYSGAQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |