About 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride
5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride (PubChem CID 90670592) has the molecular formula C20H20ClNO4
and a molecular weight of 373.84 g/mol. Its IUPAC name is 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride.
Molecular Properties
| Compound Name | 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride |
| PubChem CID | 90670592 |
| Molecular Formula | C20H20ClNO4 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride |
| SMILES | COc1ccc(-c2cccc(-c3ccc(OC)c(O)c3)n2)c(OC)c1.Cl |
| InChI | InChI=1S/C20H19NO4.ClH/c1-23-14-8-9-15(20(12-14)25-3)17-6-4-5-16(21-17)13-7-10-19(24-2)18(22)11-13;/h4-12,22H,1-3H3;1H |
| InChIKey | NFHZGDUCWPJPIU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride?
The IUPAC name of 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride (CID 90670592) is 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride.
What is the SMILES notation for 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride?
The canonical SMILES for 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride is COc1ccc(-c2cccc(-c3ccc(OC)c(O)c3)n2)c(OC)c1.Cl.
What is the InChIKey of 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride?
The InChIKey is NFHZGDUCWPJPIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19NO4.ClH/c1-23-14-8-9-15(20(12-14)25-3)17-6-4-5-16(21-17)13-7-10-19(24-2)18(22)11-13;/h4-12,22H,1-3H3;1H.
What are the key properties of 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride?
5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride has a molecular weight of 373.84 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[6-(2,4-dimethoxyphenyl)-2-pyridinyl]-2-methoxyphenol;hydrochloride is sourced from PubChem (CID 90670592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).