C15H22O6 — CID 90670778
(E)-6-[(1R,2R,6R)-3,6-dihydroxy-4-methoxy-2-methyl-5-oxocyclohex-3-en-1-yl]-4-methylhex-3-enoic acid (PubChem CID 90670778) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is (E)-6-[(1R,2R,6R)-3,6-dihydroxy-4-methoxy-2-methyl-5-oxocyclohex-3-en-1-yl]-4-methylhex-3-enoic acid.
| Compound Name | (E)-6-[(1R,2R,6R)-3,6-dihydroxy-4-methoxy-2-methyl-5-oxocyclohex-3-en-1-yl]-4-methylhex-3-enoic acid |
|---|---|
| PubChem CID | 90670778 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (E)-6-[(1R,2R,6R)-3,6-dihydroxy-4-methoxy-2-methyl-5-oxocyclohex-3-en-1-yl]-4-methylhex-3-enoic acid |
| SMILES | COC1=C(O)[C@H](C)[C@@H](CC/C(C)=C/CC(=O)O)[C@@H](O)C1=O |
| InChI | InChI=1S/C15H22O6/c1-8(5-7-11(16)17)4-6-10-9(2)12(18)15(21-3)14(20)13(10)19/h5,9-10,13,18-19H,4,6-7H2,1-3H3,(H,16,17)/b8-5+/t9-,10-,13-/m1/s1 |
| InChIKey | QXQXWYVNWULOFL-AWGWZKFLSA-N |
| XLogP | 1.80 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|