About 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea
1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea (PubChem CID 90670925) has the molecular formula C24H22N4O2
and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea.
Molecular Properties
| Compound Name | 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea |
| PubChem CID | 90670925 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)Nc1cnc2ccccn2c1=O |
| InChI | InChI=1S/C24H22N4O2/c29-23-21(17-26-22-13-7-8-16-28(22)23)27-24(30)25-15-14-20(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-13,16-17,20H,14-15H2,(H2,25,27,30) |
| InChIKey | HRTVMRZSMMFHSB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 75.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
The IUPAC name of 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea (CID 90670925) is 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea.
What is the SMILES notation for 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
The canonical SMILES for 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea is O=C(NCCC(c1ccccc1)c1ccccc1)Nc1cnc2ccccn2c1=O.
What is the InChIKey of 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
The InChIKey is HRTVMRZSMMFHSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22N4O2/c29-23-21(17-26-22-13-7-8-16-28(22)23)27-24(30)25-15-14-20(18-9-3-1-4-10-18)19-11-5-2-6-12-19/h1-13,16-17,20H,14-15H2,(H2,25,27,30).
What are the key properties of 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea?
1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea has a molecular weight of 398.47 g/mol, XLogP of 4.04, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diphenylpropyl)-3-(4-oxopyrido[1,2-a]pyrimidin-3-yl)urea is sourced from PubChem (CID 90670925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).