About 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea
1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea (PubChem CID 90670926) has the molecular formula C21H17N5O3
and a molecular weight of 387.40 g/mol. Its IUPAC name is 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea.
Molecular Properties
| Compound Name | 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea |
| PubChem CID | 90670926 |
| Molecular Formula | C21H17N5O3 |
| Molecular Weight | 387.40 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea |
| SMILES | O=C(Nc1ncccc1OCc1ccccc1)Nc1cnc2ccccn2c1=O |
| InChI | InChI=1S/C21H17N5O3/c27-20-16(13-23-18-10-4-5-12-26(18)20)24-21(28)25-19-17(9-6-11-22-19)29-14-15-7-2-1-3-8-15/h1-13H,14H2,(H2,22,24,25,28) |
| InChIKey | WXADIWWDRKIWPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea?
The IUPAC name of 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea (CID 90670926) is 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea.
What is the SMILES notation for 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea?
The canonical SMILES for 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea is O=C(Nc1ncccc1OCc1ccccc1)Nc1cnc2ccccn2c1=O.
What is the InChIKey of 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea?
The InChIKey is WXADIWWDRKIWPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N5O3/c27-20-16(13-23-18-10-4-5-12-26(18)20)24-21(28)25-19-17(9-6-11-22-19)29-14-15-7-2-1-3-8-15/h1-13H,14H2,(H2,22,24,25,28).
What are the key properties of 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea?
1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea has a molecular weight of 387.40 g/mol, XLogP of 3.31, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-oxopyrido[1,2-a]pyrimidin-3-yl)-3-(3-phenylmethoxy-2-pyridinyl)urea is sourced from PubChem (CID 90670926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).