C32H40N2O — CID 90670986
(1R,4R)-1,7,7-trimethyl-N-[4-[4-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]phenoxy]phenyl]bicyclo[2.2.1]heptan-2-imine (PubChem CID 90670986) has the molecular formula C32H40N2O and a molecular weight of 468.69 g/mol. Its IUPAC name is (1R,4R)-1,7,7-trimethyl-N-[4-[4-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]phenoxy]phenyl]bicyclo[2.2.1]heptan-2-imine.
| Compound Name | (1R,4R)-1,7,7-trimethyl-N-[4-[4-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]phenoxy]phenyl]bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 90670986 |
| Molecular Formula | C32H40N2O |
| Molecular Weight | 468.69 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (1R,4R)-1,7,7-trimethyl-N-[4-[4-[[(1R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]phenoxy]phenyl]bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/c1ccc(Oc3ccc(/N=C4\C[C@H]5CC[C@]4(C)C5(C)C)cc3)cc1)C2 |
| InChI | InChI=1S/C32H40N2O/c1-29(2)21-15-17-31(29,5)27(19-21)33-23-7-11-25(12-8-23)35-26-13-9-24(10-14-26)34-28-20-22-16-18-32(28,6)30(22,3)4/h7-14,21-22H,15-20H2,1-6H3/b33-27+,34-28+/t21-,22-,31+,32+/m1/s1 |
| InChIKey | KRLUBRACOIOKBQ-FXXUKHRSSA-N |
| XLogP | 9.32 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.69 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|