C26H48N2 — CID 90670987
N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine (PubChem CID 90670987) has the molecular formula C26H48N2 and a molecular weight of 388.68 g/mol. Its IUPAC name is N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine.
| Compound Name | N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine |
|---|---|
| PubChem CID | 90670987 |
| Molecular Formula | C26H48N2 |
| Molecular Weight | 388.68 g/mol |
| Exact Mass | 388.38 |
| IUPAC Name | N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]hexane-1,6-diamine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](NCCCCCCN[C@@H]1C[C@H]3CC[C@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C26H48N2/c1-23(2)19-11-13-25(23,5)21(17-19)27-15-9-7-8-10-16-28-22-18-20-12-14-26(22,6)24(20,3)4/h19-22,27-28H,7-18H2,1-6H3/t19-,20-,21-,22-,25+,26+/m1/s1 |
| InChIKey | OXQWWMPKQARHJR-RUNZLFIYSA-N |
| XLogP | 6.16 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.68 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|