C27H50N2 — CID 90670988
N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]heptane-1,7-diamine (PubChem CID 90670988) has the molecular formula C27H50N2 and a molecular weight of 402.71 g/mol. Its IUPAC name is N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]heptane-1,7-diamine.
| Compound Name | N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]heptane-1,7-diamine |
|---|---|
| PubChem CID | 90670988 |
| Molecular Formula | C27H50N2 |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.40 |
| IUPAC Name | N,N'-bis[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]heptane-1,7-diamine |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](NCCCCCCCN[C@@H]1C[C@H]3CC[C@]1(C)C3(C)C)C2 |
| InChI | InChI=1S/C27H50N2/c1-24(2)20-12-14-26(24,5)22(18-20)28-16-10-8-7-9-11-17-29-23-19-21-13-15-27(23,6)25(21,3)4/h20-23,28-29H,7-19H2,1-6H3/t20-,21-,22-,23-,26+,27+/m1/s1 |
| InChIKey | CHXUTRCKMKMTMW-STCUNNHWSA-N |
| XLogP | 6.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|